C14H22N4O2S — CID 103526786
3-amino-5-(4-propan-2-ylpiperidin-1-yl)thiophene-2,4-dicarboxamide (PubChem CID 103526786) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-amino-5-(4-propan-2-ylpiperidin-1-yl)thiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(4-propan-2-ylpiperidin-1-yl)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103526786 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-amino-5-(4-propan-2-ylpiperidin-1-yl)thiophene-2,4-dicarboxamide |
| SMILES | CC(C)C1CCN(c2sc(C(N)=O)c(N)c2C(N)=O)CC1 |
| InChI | InChI=1S/C14H22N4O2S/c1-7(2)8-3-5-18(6-4-8)14-9(12(16)19)10(15)11(21-14)13(17)20/h7-8H,3-6,15H2,1-2H3,(H2,16,19)(H2,17,20) |
| InChIKey | RDZAEMNDHLVDFQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |