About trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane
trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane (PubChem CID 10352685) has the molecular formula C9H15NO2Si
and a molecular weight of 197.31 g/mol. Its IUPAC name is trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane |
| PubChem CID | 10352685 |
| Molecular Formula | C9H15NO2Si |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane |
| SMILES | C=C(O[Si](C)(C)C)c1cc(C)no1 |
| InChI | InChI=1S/C9H15NO2Si/c1-7-6-9(11-10-7)8(2)12-13(3,4)5/h6H,2H2,1,3-5H3 |
| InChIKey | XNLFQENDHYNKBZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane?
The IUPAC name of trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane (CID 10352685) is trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane.
What is the SMILES notation for trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane?
The canonical SMILES for trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane is C=C(O[Si](C)(C)C)c1cc(C)no1.
What is the InChIKey of trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane?
The InChIKey is XNLFQENDHYNKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2Si/c1-7-6-9(11-10-7)8(2)12-13(3,4)5/h6H,2H2,1,3-5H3.
What are the key properties of trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane?
trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane has a molecular weight of 197.31 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1-(3-methyl-1,2-oxazol-5-yl)ethenoxy]silane is sourced from PubChem (CID 10352685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).