C10H12BrN3O2 — CID 103527173
N-[(5-bromofuran-2-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103527173) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103527173 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | Cc1noc(CCNCc2ccc(Br)o2)n1 |
| InChI | InChI=1S/C10H12BrN3O2/c1-7-13-10(16-14-7)4-5-12-6-8-2-3-9(11)15-8/h2-3,12H,4-6H2,1H3 |
| InChIKey | MQRLQQIHNMZGLO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|