6-methylsulfinylhexanoic acid

C7H14O3S — CID 10352752

IUPAC6-methylsulfinylhexanoic acid
SMILESCS(=O)CCCCCC(=O)O
InChIInChI=1S/C7H14O3S/c1-11(10)6-4-2-3-5-7(8)9/h2-6H2,1H3,(H,8,9)
InChIKeyLMCSMHJWQWMKAE-UHFFFAOYSA-N
MW178.25 g/mol
LogP1.01
Rot. Bonds6

About 6-methylsulfinylhexanoic acid

6-methylsulfinylhexanoic acid (PubChem CID 10352752) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is 6-methylsulfinylhexanoic acid.

Molecular Properties

Compound Name6-methylsulfinylhexanoic acid
PubChem CID10352752
Molecular FormulaC7H14O3S
Molecular Weight178.25 g/mol
Exact Mass178.07
IUPAC Name6-methylsulfinylhexanoic acid
SMILESCS(=O)CCCCCC(=O)O
InChIInChI=1S/C7H14O3S/c1-11(10)6-4-2-3-5-7(8)9/h2-6H2,1H3,(H,8,9)
InChIKeyLMCSMHJWQWMKAE-UHFFFAOYSA-N
XLogP1.01
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.25
LogP ≤ 51.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-methylsulfinylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methylsulfinylhexanoic acid?
The IUPAC name of 6-methylsulfinylhexanoic acid (CID 10352752) is 6-methylsulfinylhexanoic acid.
What is the SMILES notation for 6-methylsulfinylhexanoic acid?
The canonical SMILES for 6-methylsulfinylhexanoic acid is CS(=O)CCCCCC(=O)O.
What is the InChIKey of 6-methylsulfinylhexanoic acid?
The InChIKey is LMCSMHJWQWMKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-11(10)6-4-2-3-5-7(8)9/h2-6H2,1H3,(H,8,9).
What are the key properties of 6-methylsulfinylhexanoic acid?
6-methylsulfinylhexanoic acid has a molecular weight of 178.25 g/mol, XLogP of 1.01, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfinylhexanoic acid is sourced from PubChem (CID 10352752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).