About 6-methylsulfinylhexanoic acid
6-methylsulfinylhexanoic acid (PubChem CID 10352752) has the molecular formula C7H14O3S
and a molecular weight of 178.25 g/mol. Its IUPAC name is 6-methylsulfinylhexanoic acid.
Molecular Properties
| Compound Name | 6-methylsulfinylhexanoic acid |
| PubChem CID | 10352752 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-methylsulfinylhexanoic acid |
| SMILES | CS(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C7H14O3S/c1-11(10)6-4-2-3-5-7(8)9/h2-6H2,1H3,(H,8,9) |
| InChIKey | LMCSMHJWQWMKAE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylsulfinylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfinylhexanoic acid?
The IUPAC name of 6-methylsulfinylhexanoic acid (CID 10352752) is 6-methylsulfinylhexanoic acid.
What is the SMILES notation for 6-methylsulfinylhexanoic acid?
The canonical SMILES for 6-methylsulfinylhexanoic acid is CS(=O)CCCCCC(=O)O.
What is the InChIKey of 6-methylsulfinylhexanoic acid?
The InChIKey is LMCSMHJWQWMKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-11(10)6-4-2-3-5-7(8)9/h2-6H2,1H3,(H,8,9).
What are the key properties of 6-methylsulfinylhexanoic acid?
6-methylsulfinylhexanoic acid has a molecular weight of 178.25 g/mol, XLogP of 1.01, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfinylhexanoic acid is sourced from PubChem (CID 10352752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).