About 4-fluoro-1,2-dimethylpyrazol-2-ium
4-fluoro-1,2-dimethylpyrazol-2-ium (PubChem CID 10352804) has the molecular formula C5H8FN2+
and a molecular weight of 115.13 g/mol. Its IUPAC name is 4-fluoro-1,2-dimethylpyrazol-2-ium.
Molecular Properties
| Compound Name | 4-fluoro-1,2-dimethylpyrazol-2-ium |
| PubChem CID | 10352804 |
| Molecular Formula | C5H8FN2+ |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | 4-fluoro-1,2-dimethylpyrazol-2-ium |
| SMILES | Cn1cc(F)c[n+]1C |
| InChI | InChI=1S/C5H8FN2/c1-7-3-5(6)4-8(7)2/h3-4H,1-2H3/q+1 |
| InChIKey | ABILLIBPNZWQFP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1,2-dimethylpyrazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2-dimethylpyrazol-2-ium?
The IUPAC name of 4-fluoro-1,2-dimethylpyrazol-2-ium (CID 10352804) is 4-fluoro-1,2-dimethylpyrazol-2-ium.
What is the SMILES notation for 4-fluoro-1,2-dimethylpyrazol-2-ium?
The canonical SMILES for 4-fluoro-1,2-dimethylpyrazol-2-ium is Cn1cc(F)c[n+]1C.
What is the InChIKey of 4-fluoro-1,2-dimethylpyrazol-2-ium?
The InChIKey is ABILLIBPNZWQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN2/c1-7-3-5(6)4-8(7)2/h3-4H,1-2H3/q+1.
What are the key properties of 4-fluoro-1,2-dimethylpyrazol-2-ium?
4-fluoro-1,2-dimethylpyrazol-2-ium has a molecular weight of 115.13 g/mol, XLogP of -0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2-dimethylpyrazol-2-ium is sourced from PubChem (CID 10352804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).