C12H19F4NO3 — CID 103528794
ethyl 3,3-dimethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)butanoate (PubChem CID 103528794) has the molecular formula C12H19F4NO3 and a molecular weight of 301.28 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 103528794 |
| Molecular Formula | C12H19F4NO3 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(2,2,3,3-tetrafluoropropylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NCC(F)(F)C(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H19F4NO3/c1-5-20-9(19)7(11(2,3)4)8(18)17-6-12(15,16)10(13)14/h7,10H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | WEWNLMHOGQZVQC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|