C8H7F4N3O2 — CID 103528798
6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridazine-3-carboxamide (PubChem CID 103528798) has the molecular formula C8H7F4N3O2 and a molecular weight of 253.16 g/mol. Its IUPAC name is 6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103528798 |
| Molecular Formula | C8H7F4N3O2 |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C8H7F4N3O2/c9-7(10)8(11,12)3-13-6(17)4-1-2-5(16)15-14-4/h1-2,7H,3H2,(H,13,17)(H,15,16) |
| InChIKey | MDCAPRBCSSKTDY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|