C12H12ClF4N — CID 103529271
5-chloro-N-(2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 103529271) has the molecular formula C12H12ClF4N and a molecular weight of 281.68 g/mol. Its IUPAC name is 5-chloro-N-(2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-(2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 103529271 |
| Molecular Formula | C12H12ClF4N |
| Molecular Weight | 281.68 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 5-chloro-N-(2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | FC(F)C(F)(F)CNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H12ClF4N/c13-9-2-1-7-4-10(5-8(7)3-9)18-6-12(16,17)11(14)15/h1-3,10-11,18H,4-6H2 |
| InChIKey | SDJONHSVTVLAPK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.68 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|