C14H24F4N2O2 — CID 103529339
tert-butyl N-[[2-(2,2,3,3-tetrafluoropropylamino)cyclopentyl]methyl]carbamate (PubChem CID 103529339) has the molecular formula C14H24F4N2O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is tert-butyl N-[[2-(2,2,3,3-tetrafluoropropylamino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(2,2,3,3-tetrafluoropropylamino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 103529339 |
| Molecular Formula | C14H24F4N2O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl N-[[2-(2,2,3,3-tetrafluoropropylamino)cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H24F4N2O2/c1-13(2,3)22-12(21)19-7-9-5-4-6-10(9)20-8-14(17,18)11(15)16/h9-11,20H,4-8H2,1-3H3,(H,19,21) |
| InChIKey | BPEVQXAQDZTMOB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|