C12H10ClF4NO — CID 103529403
N-[(2-chloro-1-benzofuran-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529403) has the molecular formula C12H10ClF4NO and a molecular weight of 295.66 g/mol. Its IUPAC name is N-[(2-chloro-1-benzofuran-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(2-chloro-1-benzofuran-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529403 |
| Molecular Formula | C12H10ClF4NO |
| Molecular Weight | 295.66 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-[(2-chloro-1-benzofuran-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | FC(F)C(F)(F)CNCc1c(Cl)oc2ccccc12 |
| InChI | InChI=1S/C12H10ClF4NO/c13-10-8(5-18-6-12(16,17)11(14)15)7-3-1-2-4-9(7)19-10/h1-4,11,18H,5-6H2 |
| InChIKey | SFEBVVVCWSKPNL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|