C11H15F4N — CID 103529410
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529410) has the molecular formula C11H15F4N and a molecular weight of 237.24 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529410 |
| Molecular Formula | C11H15F4N |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | FC(F)C(F)(F)CNCC1CC2C=CC1C2 |
| InChI | InChI=1S/C11H15F4N/c12-10(13)11(14,15)6-16-5-9-4-7-1-2-8(9)3-7/h1-2,7-10,16H,3-6H2 |
| InChIKey | WEKLHVOOCPNWMA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|