C10H17F4N — CID 103529444
2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine (PubChem CID 103529444) has the molecular formula C10H17F4N and a molecular weight of 227.24 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine.
| Compound Name | 2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 103529444 |
| Molecular Formula | C10H17F4N |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclopentan-1-amine |
| SMILES | CC1(C)CCCC1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H17F4N/c1-9(2)5-3-4-7(9)15-6-10(13,14)8(11)12/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | QDXKMDKQGWFYJD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|