C8H7BrClF4NS — CID 103529544
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529544) has the molecular formula C8H7BrClF4NS and a molecular weight of 340.57 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529544 |
| Molecular Formula | C8H7BrClF4NS |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | FC(F)C(F)(F)CNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C8H7BrClF4NS/c9-5-1-4(16-6(5)10)2-15-3-8(13,14)7(11)12/h1,7,15H,2-3H2 |
| InChIKey | KHZNJCQYDVROLT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|