About 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol
4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol (PubChem CID 10352997) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol |
| PubChem CID | 10352997 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol |
| SMILES | Oc1ccc([C@H](O)C2=NCCN2)cc1O |
| InChI | InChI=1S/C10H12N2O3/c13-7-2-1-6(5-8(7)14)9(15)10-11-3-4-12-10/h1-2,5,9,13-15H,3-4H2,(H,11,12)/t9-/m0/s1 |
| InChIKey | QXTDBFMUJTXKNQ-VIFPVBQESA-N |
| XLogP | 0.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol?
The IUPAC name of 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol (CID 10352997) is 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol.
What is the SMILES notation for 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol?
The canonical SMILES for 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol is Oc1ccc([C@H](O)C2=NCCN2)cc1O.
What is the InChIKey of 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol?
The InChIKey is QXTDBFMUJTXKNQ-VIFPVBQESA-N. The full InChI is InChI=1S/C10H12N2O3/c13-7-2-1-6(5-8(7)14)9(15)10-11-3-4-12-10/h1-2,5,9,13-15H,3-4H2,(H,11,12)/t9-/m0/s1.
What are the key properties of 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol?
4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol has a molecular weight of 208.22 g/mol, XLogP of 0.13, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(S)-4,5-dihydro-1H-imidazol-2-yl(hydroxy)methyl]benzene-1,2-diol is sourced from PubChem (CID 10352997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).