C11H21F3N2O2 — CID 103530991
2-(3,4-dimethoxypyrrolidin-1-yl)-1,1,1-trifluoropentan-3-amine (PubChem CID 103530991) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)-1,1,1-trifluoropentan-3-amine.
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-1,1,1-trifluoropentan-3-amine |
|---|---|
| PubChem CID | 103530991 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-1,1,1-trifluoropentan-3-amine |
| SMILES | CCC(N)C(N1CC(OC)C(OC)C1)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-4-7(15)10(11(12,13)14)16-5-8(17-2)9(6-16)18-3/h7-10H,4-6,15H2,1-3H3 |
| InChIKey | HWSDAMUAOQPWHU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |