C14H22N2O3 — CID 103531079
2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]aniline (PubChem CID 103531079) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]aniline.
| Compound Name | 2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 103531079 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]aniline |
| SMILES | COC1CN(CCOc2ccccc2N)CC1OC |
| InChI | InChI=1S/C14H22N2O3/c1-17-13-9-16(10-14(13)18-2)7-8-19-12-6-4-3-5-11(12)15/h3-6,13-14H,7-10,15H2,1-2H3 |
| InChIKey | NOKMNSPHLJXWNB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|