C7H13NO5S — CID 103531325
2-(3-methoxypyrrolidin-1-yl)sulfonylacetic acid (PubChem CID 103531325) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-(3-methoxypyrrolidin-1-yl)sulfonylacetic acid.
| Compound Name | 2-(3-methoxypyrrolidin-1-yl)sulfonylacetic acid |
|---|---|
| PubChem CID | 103531325 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-(3-methoxypyrrolidin-1-yl)sulfonylacetic acid |
| SMILES | COC1CCN(S(=O)(=O)CC(=O)O)C1 |
| InChI | InChI=1S/C7H13NO5S/c1-13-6-2-3-8(4-6)14(11,12)5-7(9)10/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | HDEMVNHSSZBKTK-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |