About 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol
3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol (PubChem CID 103532598) has the molecular formula C11H24N2O3
and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol |
| PubChem CID | 103532598 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol |
| SMILES | CCC(N)C(CO)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C11H24N2O3/c1-4-8(12)9(7-14)13-5-10(15-2)11(6-13)16-3/h8-11,14H,4-7,12H2,1-3H3 |
| InChIKey | ATFOPLBBEYMXAZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol?
The IUPAC name of 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol (CID 103532598) is 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol.
What is the SMILES notation for 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol?
The canonical SMILES for 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol is CCC(N)C(CO)N1CC(OC)C(OC)C1.
What is the InChIKey of 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol?
The InChIKey is ATFOPLBBEYMXAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O3/c1-4-8(12)9(7-14)13-5-10(15-2)11(6-13)16-3/h8-11,14H,4-7,12H2,1-3H3.
What are the key properties of 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol?
3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol has a molecular weight of 232.32 g/mol, XLogP of -0.57, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3,4-dimethoxypyrrolidin-1-yl)pentan-1-ol is sourced from PubChem (CID 103532598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).