C13H16N2O — CID 10353268
2-(3,7,8,9-tetrahydropyrano[3,2-e]indol-1-yl)ethanamine (PubChem CID 10353268) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(3,7,8,9-tetrahydropyrano[3,2-e]indol-1-yl)ethanamine.
| Compound Name | 2-(3,7,8,9-tetrahydropyrano[3,2-e]indol-1-yl)ethanamine |
|---|---|
| PubChem CID | 10353268 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-(3,7,8,9-tetrahydropyrano[3,2-e]indol-1-yl)ethanamine |
| SMILES | NCCc1c[nH]c2ccc3c(c12)CCCO3 |
| InChI | InChI=1S/C13H16N2O/c14-6-5-9-8-15-11-3-4-12-10(13(9)11)2-1-7-16-12/h3-4,8,15H,1-2,5-7,14H2 |
| InChIKey | CRBUBLCOTKWRPR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |