C10H17NO3 — CID 103533267
1-(3-methoxypyrrolidin-1-yl)pentane-1,4-dione (PubChem CID 103533267) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(3-methoxypyrrolidin-1-yl)pentane-1,4-dione.
| Compound Name | 1-(3-methoxypyrrolidin-1-yl)pentane-1,4-dione |
|---|---|
| PubChem CID | 103533267 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(3-methoxypyrrolidin-1-yl)pentane-1,4-dione |
| SMILES | COC1CCN(C(=O)CCC(C)=O)C1 |
| InChI | InChI=1S/C10H17NO3/c1-8(12)3-4-10(13)11-6-5-9(7-11)14-2/h9H,3-7H2,1-2H3 |
| InChIKey | XFKMNPUWLCUZNL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |