About 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide
2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide (PubChem CID 103533673) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide |
| PubChem CID | 103533673 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide |
| SMILES | COC1CN(c2nc(C)ccc2C(N)=S)CC1OC |
| InChI | InChI=1S/C13H19N3O2S/c1-8-4-5-9(12(14)19)13(15-8)16-6-10(17-2)11(7-16)18-3/h4-5,10-11H,6-7H2,1-3H3,(H2,14,19) |
| InChIKey | QOXUNFVAZHYDGB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide?
The IUPAC name of 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide (CID 103533673) is 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide.
What is the SMILES notation for 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide?
The canonical SMILES for 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide is COC1CN(c2nc(C)ccc2C(N)=S)CC1OC.
What is the InChIKey of 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide?
The InChIKey is QOXUNFVAZHYDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S/c1-8-4-5-9(12(14)19)13(15-8)16-6-10(17-2)11(7-16)18-3/h4-5,10-11H,6-7H2,1-3H3,(H2,14,19).
What are the key properties of 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide?
2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide has a molecular weight of 281.38 g/mol, XLogP of 0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxypyrrolidin-1-yl)-6-methylpyridine-3-carbothioamide is sourced from PubChem (CID 103533673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).