C15H18N4O2 — CID 103533970
N'-hydroxy-2-(3-methoxypyrrolidin-1-yl)quinoline-3-carboximidamide (PubChem CID 103533970) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N'-hydroxy-2-(3-methoxypyrrolidin-1-yl)quinoline-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(3-methoxypyrrolidin-1-yl)quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 103533970 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N'-hydroxy-2-(3-methoxypyrrolidin-1-yl)quinoline-3-carboximidamide |
| SMILES | COC1CCN(c2nc3ccccc3cc2/C(N)=N/O)C1 |
| InChI | InChI=1S/C15H18N4O2/c1-21-11-6-7-19(9-11)15-12(14(16)18-20)8-10-4-2-3-5-13(10)17-15/h2-5,8,11,20H,6-7,9H2,1H3,(H2,16,18) |
| InChIKey | XVOZODGIVBACBU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|