C9H16F3N3O2 — CID 103534024
3,3,3-trifluoro-N'-hydroxy-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide (PubChem CID 103534024) has the molecular formula C9H16F3N3O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103534024 |
| Molecular Formula | C9H16F3N3O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide |
| SMILES | COC1CCN(CC(C(N)=NO)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3N3O2/c1-17-6-2-3-15(4-6)5-7(8(13)14-16)9(10,11)12/h6-7,16H,2-5H2,1H3,(H2,13,14) |
| InChIKey | MRUGBLHBJGOTHI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|