C12H15NOS — CID 10353467
1-(2,3,4,5-tetrahydro-1,6-benzothiazocin-6-yl)ethanone (PubChem CID 10353467) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-(2,3,4,5-tetrahydro-1,6-benzothiazocin-6-yl)ethanone.
| Compound Name | 1-(2,3,4,5-tetrahydro-1,6-benzothiazocin-6-yl)ethanone |
|---|---|
| PubChem CID | 10353467 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-(2,3,4,5-tetrahydro-1,6-benzothiazocin-6-yl)ethanone |
| SMILES | CC(=O)N1CCCCSc2ccccc21 |
| InChI | InChI=1S/C12H15NOS/c1-10(14)13-8-4-5-9-15-12-7-3-2-6-11(12)13/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | IDFUWPYVPHJQMZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |