About 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde
4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde (PubChem CID 103535011) has the molecular formula C13H15F2NO3
and a molecular weight of 271.26 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde |
| PubChem CID | 103535011 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde |
| SMILES | COC1CN(c2c(F)cc(C=O)cc2F)CC1OC |
| InChI | InChI=1S/C13H15F2NO3/c1-18-11-5-16(6-12(11)19-2)13-9(14)3-8(7-17)4-10(13)15/h3-4,7,11-12H,5-6H2,1-2H3 |
| InChIKey | TWMPENYGEORRNY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde?
The IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde (CID 103535011) is 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde.
What is the SMILES notation for 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde?
The canonical SMILES for 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde is COC1CN(c2c(F)cc(C=O)cc2F)CC1OC.
What is the InChIKey of 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde?
The InChIKey is TWMPENYGEORRNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO3/c1-18-11-5-16(6-12(11)19-2)13-9(14)3-8(7-17)4-10(13)15/h3-4,7,11-12H,5-6H2,1-2H3.
What are the key properties of 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde?
4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde has a molecular weight of 271.26 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxypyrrolidin-1-yl)-3,5-difluorobenzaldehyde is sourced from PubChem (CID 103535011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).