C10H16N2O5 — CID 103535057
4-[(3-methoxypyrrolidine-1-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 103535057) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-[(3-methoxypyrrolidine-1-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(3-methoxypyrrolidine-1-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103535057 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-[(3-methoxypyrrolidine-1-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | COC1CCN(C(=O)NC(=O)CCC(=O)O)C1 |
| InChI | InChI=1S/C10H16N2O5/c1-17-7-4-5-12(6-7)10(16)11-8(13)2-3-9(14)15/h7H,2-6H2,1H3,(H,14,15)(H,11,13,16) |
| InChIKey | HZXCDDJZPHJTGL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |