C14H22O2 — CID 10353518
(3aR,3bR,6aS,7R,7aR)-7-hydroxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one (PubChem CID 10353518) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3aR,3bR,6aS,7R,7aR)-7-hydroxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one.
| Compound Name | (3aR,3bR,6aS,7R,7aR)-7-hydroxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one |
|---|---|
| PubChem CID | 10353518 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3aR,3bR,6aS,7R,7aR)-7-hydroxy-3a,3b,7a-trimethyl-2,3,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalen-5-one |
| SMILES | C[C@]12CCC[C@@]1(C)[C@H](O)[C@H]1CC(=O)C[C@]12C |
| InChI | InChI=1S/C14H22O2/c1-12-5-4-6-14(12,3)13(2)8-9(15)7-10(13)11(12)16/h10-11,16H,4-8H2,1-3H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | BMDLJAUIXVPHGU-RGDJUOJXSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |