C15H21NO4 — CID 103535688
2-(3,4-dimethoxypyrrolidin-1-yl)-1-(4-methoxyphenyl)ethanone (PubChem CID 103535688) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 103535688 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CN2CC(OC)C(OC)C2)cc1 |
| InChI | InChI=1S/C15H21NO4/c1-18-12-6-4-11(5-7-12)13(17)8-16-9-14(19-2)15(10-16)20-3/h4-7,14-15H,8-10H2,1-3H3 |
| InChIKey | QFFVYQORKAQVKN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |