C11H18N4O — CID 103535803
1-[2-(3-methoxypyrrolidin-1-yl)pyrimidin-5-yl]-N-methylmethanamine (PubChem CID 103535803) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-[2-(3-methoxypyrrolidin-1-yl)pyrimidin-5-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(3-methoxypyrrolidin-1-yl)pyrimidin-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 103535803 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-[2-(3-methoxypyrrolidin-1-yl)pyrimidin-5-yl]-N-methylmethanamine |
| SMILES | CNCc1cnc(N2CCC(OC)C2)nc1 |
| InChI | InChI=1S/C11H18N4O/c1-12-5-9-6-13-11(14-7-9)15-4-3-10(8-15)16-2/h6-7,10,12H,3-5,8H2,1-2H3 |
| InChIKey | LXZCKGOJSLQTDF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |