About 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine
2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 103536671) has the molecular formula C11H13ClF3N3O2
and a molecular weight of 311.69 g/mol. Its IUPAC name is 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 103536671 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | COC1CN(c2cc(C(F)(F)F)nc(Cl)n2)CC1OC |
| InChI | InChI=1S/C11H13ClF3N3O2/c1-19-6-4-18(5-7(6)20-2)9-3-8(11(13,14)15)16-10(12)17-9/h3,6-7H,4-5H2,1-2H3 |
| InChIKey | CPOJQDFMUCGVST-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine (CID 103536671) is 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine is COC1CN(c2cc(C(F)(F)F)nc(Cl)n2)CC1OC.
What is the InChIKey of 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine?
The InChIKey is CPOJQDFMUCGVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClF3N3O2/c1-19-6-4-18(5-7(6)20-2)9-3-8(11(13,14)15)16-10(12)17-9/h3,6-7H,4-5H2,1-2H3.
What are the key properties of 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine?
2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine has a molecular weight of 311.69 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 103536671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).