About 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine
1-(4-bromobutyl)-3,4-dimethoxypyrrolidine (PubChem CID 103537337) has the molecular formula C10H20BrNO2
and a molecular weight of 266.18 g/mol. Its IUPAC name is 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine.
Molecular Properties
| Compound Name | 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine |
| PubChem CID | 103537337 |
| Molecular Formula | C10H20BrNO2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine |
| SMILES | COC1CN(CCCCBr)CC1OC |
| InChI | InChI=1S/C10H20BrNO2/c1-13-9-7-12(6-4-3-5-11)8-10(9)14-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | ATMYLDWBEOATEO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine?
The IUPAC name of 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine (CID 103537337) is 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine.
What is the SMILES notation for 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine?
The canonical SMILES for 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine is COC1CN(CCCCBr)CC1OC.
What is the InChIKey of 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine?
The InChIKey is ATMYLDWBEOATEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO2/c1-13-9-7-12(6-4-3-5-11)8-10(9)14-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine?
1-(4-bromobutyl)-3,4-dimethoxypyrrolidine has a molecular weight of 266.18 g/mol, XLogP of 1.51, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromobutyl)-3,4-dimethoxypyrrolidine is sourced from PubChem (CID 103537337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).