About 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine
3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine (PubChem CID 103538339) has the molecular formula C11H16ClN3O4S
and a molecular weight of 321.79 g/mol. Its IUPAC name is 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine |
| PubChem CID | 103538339 |
| Molecular Formula | C11H16ClN3O4S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine |
| SMILES | COC1CN(S(=O)(=O)c2cnc(N)c(Cl)c2)CC1OC |
| InChI | InChI=1S/C11H16ClN3O4S/c1-18-9-5-15(6-10(9)19-2)20(16,17)7-3-8(12)11(13)14-4-7/h3-4,9-10H,5-6H2,1-2H3,(H2,13,14) |
| InChIKey | SDRQEIPRQSQQGO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine?
The IUPAC name of 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine (CID 103538339) is 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine.
What is the SMILES notation for 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine?
The canonical SMILES for 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine is COC1CN(S(=O)(=O)c2cnc(N)c(Cl)c2)CC1OC.
What is the InChIKey of 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine?
The InChIKey is SDRQEIPRQSQQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN3O4S/c1-18-9-5-15(6-10(9)19-2)20(16,17)7-3-8(12)11(13)14-4-7/h3-4,9-10H,5-6H2,1-2H3,(H2,13,14).
What are the key properties of 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine?
3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine has a molecular weight of 321.79 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(3,4-dimethoxypyrrolidin-1-yl)sulfonylpyridin-2-amine is sourced from PubChem (CID 103538339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).