C12H25NO2 — CID 103539229
1-(3-methoxypyrrolidin-1-yl)-4,4-dimethylpentan-3-ol (PubChem CID 103539229) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(3-methoxypyrrolidin-1-yl)-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(3-methoxypyrrolidin-1-yl)-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 103539229 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 1-(3-methoxypyrrolidin-1-yl)-4,4-dimethylpentan-3-ol |
| SMILES | COC1CCN(CCC(O)C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25NO2/c1-12(2,3)11(14)6-8-13-7-5-10(9-13)15-4/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | RBVBBTYXPOLEJV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |