C10H20N2O2 — CID 103540489
1-(3,4-dimethoxypyrrolidin-1-yl)butan-1-imine (PubChem CID 103540489) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(3,4-dimethoxypyrrolidin-1-yl)butan-1-imine.
| Compound Name | 1-(3,4-dimethoxypyrrolidin-1-yl)butan-1-imine |
|---|---|
| PubChem CID | 103540489 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-(3,4-dimethoxypyrrolidin-1-yl)butan-1-imine |
| SMILES | [H]/N=C(\CCC)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-4-5-10(11)12-6-8(13-2)9(7-12)14-3/h8-9,11H,4-7H2,1-3H3/b11-10+ |
| InChIKey | GBXTYKOZQAPIHG-ZHACJKMWSA-N |
| XLogP | 1.11 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|