About 2-(aminomethyl)-3,5-ditert-butylphenol
2-(aminomethyl)-3,5-ditert-butylphenol (PubChem CID 10354063) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(aminomethyl)-3,5-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3,5-ditert-butylphenol |
| PubChem CID | 10354063 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-(aminomethyl)-3,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(O)c(CN)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO/c1-14(2,3)10-7-12(15(4,5)6)11(9-16)13(17)8-10/h7-8,17H,9,16H2,1-6H3 |
| InChIKey | ZUSLEOOZAITYGH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-3,5-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3,5-ditert-butylphenol?
The IUPAC name of 2-(aminomethyl)-3,5-ditert-butylphenol (CID 10354063) is 2-(aminomethyl)-3,5-ditert-butylphenol.
What is the SMILES notation for 2-(aminomethyl)-3,5-ditert-butylphenol?
The canonical SMILES for 2-(aminomethyl)-3,5-ditert-butylphenol is CC(C)(C)c1cc(O)c(CN)c(C(C)(C)C)c1.
What is the InChIKey of 2-(aminomethyl)-3,5-ditert-butylphenol?
The InChIKey is ZUSLEOOZAITYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-14(2,3)10-7-12(15(4,5)6)11(9-16)13(17)8-10/h7-8,17H,9,16H2,1-6H3.
What are the key properties of 2-(aminomethyl)-3,5-ditert-butylphenol?
2-(aminomethyl)-3,5-ditert-butylphenol has a molecular weight of 235.37 g/mol, XLogP of 3.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3,5-ditert-butylphenol is sourced from PubChem (CID 10354063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).