About 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine
2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine (PubChem CID 103540653) has the molecular formula C14H21FN2O2
and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine |
| PubChem CID | 103540653 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine |
| SMILES | COC1CN(c2ccc(CCN)cc2F)CC1OC |
| InChI | InChI=1S/C14H21FN2O2/c1-18-13-8-17(9-14(13)19-2)12-4-3-10(5-6-16)7-11(12)15/h3-4,7,13-14H,5-6,8-9,16H2,1-2H3 |
| InChIKey | KPANXYDKDDOEBN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine?
The IUPAC name of 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine (CID 103540653) is 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine.
What is the SMILES notation for 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine?
The canonical SMILES for 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine is COC1CN(c2ccc(CCN)cc2F)CC1OC.
What is the InChIKey of 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine?
The InChIKey is KPANXYDKDDOEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FN2O2/c1-18-13-8-17(9-14(13)19-2)12-4-3-10(5-6-16)7-11(12)15/h3-4,7,13-14H,5-6,8-9,16H2,1-2H3.
What are the key properties of 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine?
2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine has a molecular weight of 268.33 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dimethoxypyrrolidin-1-yl)-3-fluorophenyl]ethanamine is sourced from PubChem (CID 103540653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).