About [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol
[2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol (PubChem CID 103540797) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol |
| PubChem CID | 103540797 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol |
| SMILES | CNC1(CO)CCCC1CCN1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C15H30N2O3/c1-16-15(11-18)7-4-5-12(15)6-8-17-9-13(19-2)14(10-17)20-3/h12-14,16,18H,4-11H2,1-3H3 |
| InChIKey | IZVKYLRAZHHZCR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol?
The IUPAC name of [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol (CID 103540797) is [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol.
What is the SMILES notation for [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol?
The canonical SMILES for [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol is CNC1(CO)CCCC1CCN1CC(OC)C(OC)C1.
What is the InChIKey of [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol?
The InChIKey is IZVKYLRAZHHZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O3/c1-16-15(11-18)7-4-5-12(15)6-8-17-9-13(19-2)14(10-17)20-3/h12-14,16,18H,4-11H2,1-3H3.
What are the key properties of [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol?
[2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol has a molecular weight of 286.42 g/mol, XLogP of 0.47, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-1-(methylamino)cyclopentyl]methanol is sourced from PubChem (CID 103540797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).