C16H26N2O3 — CID 103540862
1-amino-4-(3,4-dimethoxypyrrolidin-1-yl)-2-phenylbutan-2-ol (PubChem CID 103540862) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-amino-4-(3,4-dimethoxypyrrolidin-1-yl)-2-phenylbutan-2-ol.
| Compound Name | 1-amino-4-(3,4-dimethoxypyrrolidin-1-yl)-2-phenylbutan-2-ol |
|---|---|
| PubChem CID | 103540862 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-amino-4-(3,4-dimethoxypyrrolidin-1-yl)-2-phenylbutan-2-ol |
| SMILES | COC1CN(CCC(O)(CN)c2ccccc2)CC1OC |
| InChI | InChI=1S/C16H26N2O3/c1-20-14-10-18(11-15(14)21-2)9-8-16(19,12-17)13-6-4-3-5-7-13/h3-7,14-15,19H,8-12,17H2,1-2H3 |
| InChIKey | XZDPYSVHIGVPOQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |