C13H19BrN2O4S — CID 103541562
[3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenyl]methanamine (PubChem CID 103541562) has the molecular formula C13H19BrN2O4S and a molecular weight of 379.28 g/mol. Its IUPAC name is [3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenyl]methanamine.
| Compound Name | [3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenyl]methanamine |
|---|---|
| PubChem CID | 103541562 |
| Molecular Formula | C13H19BrN2O4S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | [3-bromo-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenyl]methanamine |
| SMILES | COC1CN(S(=O)(=O)c2ccc(CN)cc2Br)CC1OC |
| InChI | InChI=1S/C13H19BrN2O4S/c1-19-11-7-16(8-12(11)20-2)21(17,18)13-4-3-9(6-15)5-10(13)14/h3-5,11-12H,6-8,15H2,1-2H3 |
| InChIKey | XLUDVYVUJMGHSV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |