C17H19N — CID 10354158
3-(9,10-dihydroanthracen-9-yl)propan-1-amine (PubChem CID 10354158) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-(9,10-dihydroanthracen-9-yl)propan-1-amine.
| Compound Name | 3-(9,10-dihydroanthracen-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 10354158 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(9,10-dihydroanthracen-9-yl)propan-1-amine |
| SMILES | NCCCC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H19N/c18-11-5-10-17-15-8-3-1-6-13(15)12-14-7-2-4-9-16(14)17/h1-4,6-9,17H,5,10-12,18H2 |
| InChIKey | AUTKMGMMFJXIDV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |