C13H27NO2S — CID 103541667
2-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-ethylbutane-1-thiol (PubChem CID 103541667) has the molecular formula C13H27NO2S and a molecular weight of 261.43 g/mol. Its IUPAC name is 2-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-ethylbutane-1-thiol.
| Compound Name | 2-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-ethylbutane-1-thiol |
|---|---|
| PubChem CID | 103541667 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-ethylbutane-1-thiol |
| SMILES | CCC(CC)(CS)CN1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C13H27NO2S/c1-5-13(6-2,10-17)9-14-7-11(15-3)12(8-14)16-4/h11-12,17H,5-10H2,1-4H3 |
| InChIKey | SECDJPRDPNWMBK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|