About 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine
4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 103541947) has the molecular formula C11H15F3N4O2
and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 103541947 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | COC1CN(c2cc(C(F)(F)F)nc(N)n2)CC1OC |
| InChI | InChI=1S/C11H15F3N4O2/c1-19-6-4-18(5-7(6)20-2)9-3-8(11(12,13)14)16-10(15)17-9/h3,6-7H,4-5H2,1-2H3,(H2,15,16,17) |
| InChIKey | NPPMHBHJJDIIOT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine (CID 103541947) is 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine is COC1CN(c2cc(C(F)(F)F)nc(N)n2)CC1OC.
What is the InChIKey of 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is NPPMHBHJJDIIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N4O2/c1-19-6-4-18(5-7(6)20-2)9-3-8(11(12,13)14)16-10(15)17-9/h3,6-7H,4-5H2,1-2H3,(H2,15,16,17).
What are the key properties of 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine?
4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 292.26 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxypyrrolidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 103541947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).