C12H12ClFN2 — CID 10354214
(3aR,6aS)-5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 10354214) has the molecular formula C12H12ClFN2 and a molecular weight of 238.69 g/mol. Its IUPAC name is (3aR,6aS)-5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 10354214 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (3aR,6aS)-5-(6-chloro-5-fluoro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | Fc1cc(C2=C[C@H]3CNC[C@H]3C2)cnc1Cl |
| InChI | InChI=1S/C12H12ClFN2/c13-12-11(14)3-10(6-16-12)7-1-8-4-15-5-9(8)2-7/h1,3,6,8-9,15H,2,4-5H2/t8-,9+/m0/s1 |
| InChIKey | OXLZLZNNUDEYMM-DTWKUNHWSA-N |
| XLogP | 2.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|