About N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide
N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 103542279) has the molecular formula C8H18N4O2
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide |
| PubChem CID | 103542279 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NN)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C8H18N4O2/c1-10-8(11-9)12-4-6(13-2)7(5-12)14-3/h6-7H,4-5,9H2,1-3H3,(H,10,11) |
| InChIKey | OVXZFFPQAUNYOM-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide?
The IUPAC name of N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide (CID 103542279) is N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide.
What is the SMILES notation for N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide?
The canonical SMILES for N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide is C/N=C(\NN)N1CC(OC)C(OC)C1.
What is the InChIKey of N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide?
The InChIKey is OVXZFFPQAUNYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O2/c1-10-8(11-9)12-4-6(13-2)7(5-12)14-3/h6-7H,4-5,9H2,1-3H3,(H,10,11).
What are the key properties of N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide?
N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide has a molecular weight of 202.26 g/mol, XLogP of -1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide is sourced from PubChem (CID 103542279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).