C8H18N4O2 — CID 103542279
N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 103542279) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103542279 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | N-amino-3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NN)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C8H18N4O2/c1-10-8(11-9)12-4-6(13-2)7(5-12)14-3/h6-7H,4-5,9H2,1-3H3,(H,10,11) |
| InChIKey | OVXZFFPQAUNYOM-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|