C14H20N4O2S — CID 103542443
3-amino-4-cyano-5-(3-methoxypyrrolidin-1-yl)-N-propylthiophene-2-carboxamide (PubChem CID 103542443) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-amino-4-cyano-5-(3-methoxypyrrolidin-1-yl)-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-(3-methoxypyrrolidin-1-yl)-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103542443 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-amino-4-cyano-5-(3-methoxypyrrolidin-1-yl)-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(N2CCC(OC)C2)c(C#N)c1N |
| InChI | InChI=1S/C14H20N4O2S/c1-3-5-17-13(19)12-11(16)10(7-15)14(21-12)18-6-4-9(8-18)20-2/h9H,3-6,8,16H2,1-2H3,(H,17,19) |
| InChIKey | FRCMPTVPHAFCHU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |