C12H16O5 — CID 10354255
(1R,2R,6R,8S)-8-hydroxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclopentane]-9-one (PubChem CID 10354255) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (1R,2R,6R,8S)-8-hydroxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclopentane]-9-one.
| Compound Name | (1R,2R,6R,8S)-8-hydroxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclopentane]-9-one |
|---|---|
| PubChem CID | 10354255 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1R,2R,6R,8S)-8-hydroxyspiro[3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,1'-cyclopentane]-9-one |
| SMILES | O=C1O[C@@H]2C[C@@]1(O)C[C@H]1OC3(CCCC3)O[C@@H]21 |
| InChI | InChI=1S/C12H16O5/c13-10-11(14)5-7(15-10)9-8(6-11)16-12(17-9)3-1-2-4-12/h7-9,14H,1-6H2/t7-,8-,9+,11-/m1/s1 |
| InChIKey | WZODKNSAKHPFDW-SDNRWEOFSA-N |
| XLogP | 0.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |