About 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone
1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone (PubChem CID 10354290) has the molecular formula C14H28OSi
and a molecular weight of 240.46 g/mol. Its IUPAC name is 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone.
Molecular Properties
| Compound Name | 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone |
| PubChem CID | 10354290 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@H]([Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C14H28OSi/c1-10-12(11(2)15)8-9-13(10)16(6,7)14(3,4)5/h10,12-13H,8-9H2,1-7H3/t10-,12+,13-/m0/s1 |
| InChIKey | SICZSVCABNYOID-UHTWSYAYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone?
The IUPAC name of 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone (CID 10354290) is 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone.
What is the SMILES notation for 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone?
The canonical SMILES for 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone is CC(=O)[C@@H]1CC[C@H]([Si](C)(C)C(C)(C)C)[C@H]1C.
What is the InChIKey of 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone?
The InChIKey is SICZSVCABNYOID-UHTWSYAYSA-N. The full InChI is InChI=1S/C14H28OSi/c1-10-12(11(2)15)8-9-13(10)16(6,7)14(3,4)5/h10,12-13H,8-9H2,1-7H3/t10-,12+,13-/m0/s1.
What are the key properties of 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone?
1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone has a molecular weight of 240.46 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]-2-methylcyclopentyl]ethanone is sourced from PubChem (CID 10354290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).