C9H14N4O4 — CID 10354365
(3R,4S)-3-acetamido-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10354365) has the molecular formula C9H14N4O4 and a molecular weight of 242.24 g/mol. Its IUPAC name is (3R,4S)-3-acetamido-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3R,4S)-3-acetamido-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10354365 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (3R,4S)-3-acetamido-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1COC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C9H14N4O4/c1-4(14)12-6-3-17-7(8(15)16)2-5(6)13-9(10)11/h2,5-6H,3H2,1H3,(H,12,14)(H,15,16)(H4,10,11,13)/t5-,6-/m0/s1 |
| InChIKey | RHCZMDUFTTZXEB-WDSKDSINSA-N |
| XLogP | -1.87 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|