C9H16O3 — CID 103543779
1-(1,3-dioxolan-2-yl)-3-methylpentan-2-one (PubChem CID 103543779) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-3-methylpentan-2-one.
| Compound Name | 1-(1,3-dioxolan-2-yl)-3-methylpentan-2-one |
|---|---|
| PubChem CID | 103543779 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-3-methylpentan-2-one |
| SMILES | CCC(C)C(=O)CC1OCCO1 |
| InChI | InChI=1S/C9H16O3/c1-3-7(2)8(10)6-9-11-4-5-12-9/h7,9H,3-6H2,1-2H3 |
| InChIKey | AIJGUHOPONQUKE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |