C12H16FNO2 — CID 103543902
1-(1,3-dioxolan-2-yl)-3-(2-fluorophenyl)propan-2-amine (PubChem CID 103543902) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-3-(2-fluorophenyl)propan-2-amine.
| Compound Name | 1-(1,3-dioxolan-2-yl)-3-(2-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 103543902 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-3-(2-fluorophenyl)propan-2-amine |
| SMILES | NC(Cc1ccccc1F)CC1OCCO1 |
| InChI | InChI=1S/C12H16FNO2/c13-11-4-2-1-3-9(11)7-10(14)8-12-15-5-6-16-12/h1-4,10,12H,5-8,14H2 |
| InChIKey | VKPMONPMNUMZKU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |